ChemNet > CAS > 1591-30-6 4,4'-Biphenyldicarbonitrile
1591-30-6 4,4'-Biphenyldicarbonitrile
상품명칭 |
4,4'-Biphenyldicarbonitrile |
영문 이름 |
4,4'-Biphenyldicarbonitrile; 4,4-Dicyanobiphenyl; biphenyl-4,4'-dicarbonitrile |
분자식 |
C14H8N2 |
분자량 |
204.2267 |
InChI |
InChI=1/C14H8N2/c15-9-11-1-5-13(6-2-11)14-7-3-12(10-16)4-8-14/h1-8H |
cas번호 |
1591-30-6 |
EC번호 |
216-468-6 |
분자 구조 |
|
밀도 |
1.2g/cm3 |
녹는 점 |
236-236℃ |
비등점 |
403.5°C at 760 mmHg |
굴절 지수 |
1.631 |
인화점 |
199.2°C |
증기압 |
1.02E-06mmHg at 25°C |
리스크 규칙 |
R20/22:Harmful by inhalation and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|