1608-51-1 4-Fluorochalcone
상품명칭 |
4-Fluorochalcone |
영문 이름 |
4-Fluorochalcone; 1-Phenyl-3-(4-fluorophenyl)-2-propen-1-one; 4-Fluorobenzylideneacetophenone; 3-(4-fluorophenyl)-1-phenylprop-2-en-1-one; (2E)-3-(4-fluorophenyl)-1-phenylprop-2-en-1-one |
분자식 |
C15H11FO |
분자량 |
226.2456 |
InChI |
InChI=1/C15H11FO/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13/h1-11H/b11-8+ |
cas번호 |
1608-51-1 |
분자 구조 |
|
밀도 |
1.166g/cm3 |
녹는 점 |
84℃ |
비등점 |
345.9°C at 760 mmHg |
굴절 지수 |
1.608 |
인화점 |
157.3°C |
증기압 |
5.97E-05mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|