ChemNet > CAS > 1643-15-8 (m-Tolyloxy)-acetic acid
1643-15-8 (m-Tolyloxy)-acetic acid
| 상품명칭 |
(m-Tolyloxy)-acetic acid |
| 별명 |
3-Methylphenoxyacetic acid; (3-methylphenoxy)acetic acid; (3-methylphenoxy)acetate |
| 분자식 |
C9H9O3 |
| 분자량 |
165.1665 |
| InChI |
InChI=1/C9H10O3/c1-7-3-2-4-8(5-7)12-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)/p-1 |
| cas번호 |
1643-15-8 |
| EC번호 |
216-698-7 |
| 분자 구조 |
|
| 비등점 |
300°C at 760 mmHg |
| 인화점 |
121.4°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
