ChemNet > CAS > 16789-84-7 3-Bromo-2-hydroxy-5-nitrobenzaldehyde
16789-84-7 3-Bromo-2-hydroxy-5-nitrobenzaldehyde
| 상품명칭 |
3-Bromo-2-hydroxy-5-nitrobenzaldehyde |
| 영문 이름 |
3-Bromo-2-hydroxy-5-nitrobenzaldehyde; 3-Bromo-5-nitrosalicylaldehyde |
| 분자식 |
C7H4BrNO4 |
| 분자량 |
246.015 |
| InChI |
InChI=1/C7H4BrNO4/c8-6-2-5(9(12)13)1-4(3-10)7(6)11/h1-3,11H |
| cas번호 |
16789-84-7 |
| 분자 구조 |
|
| 밀도 |
1.928g/cm3 |
| 비등점 |
299.6°C at 760 mmHg |
| 굴절 지수 |
1.696 |
| 인화점 |
135°C |
| 증기압 |
0.000662mmHg at 25°C |
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|