ChemNet > CAS > 17217-57-1 4,4'-Dimethoxy-2,2'-bipyridine
17217-57-1 4,4'-Dimethoxy-2,2'-bipyridine
상품명칭 |
4,4'-Dimethoxy-2,2'-bipyridine |
별명 |
4,4'-Dimethoxy-[2,2']bipyridinyl |
분자식 |
C12H12N2O2 |
분자량 |
216.2359 |
InChI |
InChI=1/C12H12N2O2/c1-15-9-3-5-13-11(7-9)12-8-10(16-2)4-6-14-12/h3-8H,1-2H3 |
cas번호 |
17217-57-1 |
분자 구조 |
|
밀도 |
1.143g/cm3 |
녹는 점 |
170-171℃ |
비등점 |
347.6°C at 760 mmHg |
굴절 지수 |
1.551 |
인화점 |
127°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|