1731-79-9 dimethyl dodecanedioate
상품명칭 |
dimethyl dodecanedioate |
영문 이름 |
dimethyl dodecanedioate; Dimethyl 1,10-decanedicarboxylate; 1,10-Decanedicarboxylic acid dimethyl ester~Dodecanedioic acid dimethyl ester; Dodecanedioic acid dimethyl ester; N-(2-Chloroethyl) Pyrrolinie HCl |
분자식 |
C14H26O4 |
분자량 |
258.3538 |
InChI |
InChI=1/C14H26O4/c1-17-13(15)11-9-7-5-3-4-6-8-10-12-14(16)18-2/h3-12H2,1-2H3 |
cas번호 |
1731-79-9 |
EC번호 |
217-050-6 |
분자 구조 |
|
밀도 |
0.969g/cm3 |
비등점 |
300.9°C at 760 mmHg |
굴절 지수 |
1.441 |
인화점 |
135°C |
증기압 |
0.00109mmHg at 25°C |
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|