ChemNet > CAS > 17639-76-8 Methyl 2-methoxypropionate
17639-76-8 Methyl 2-methoxypropionate
상품명칭 |
Methyl 2-methoxypropionate |
영문 이름 |
Methyl 2-methoxypropionate; 2-Methoxypropionic acid methyl ester; methyl 2-methoxypropanoate |
분자식 |
C5H10O3 |
분자량 |
118.1311 |
InChI |
InChI=1/C5H10O3/c1-4(7-2)5(6)8-3/h4H,1-3H3 |
cas번호 |
17639-76-8 |
EC번호 |
241-622-4 |
분자 구조 |
|
밀도 |
0.973g/cm3 |
비등점 |
136.2°C at 760 mmHg |
굴절 지수 |
1.389 |
인화점 |
40.6°C |
증기압 |
7.45mmHg at 25°C |
리스크 규칙 |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|