18031-40-8;2111-75-3 L(-)-Perillaldehyde
상품명칭 |
L(-)-Perillaldehyde |
영문 이름 |
L(-)-Perillaldehyde; L-4(1-Methylethenyl)-1-cyclohexene-1-carboxaldehyde; (-)-Perillaaldehyde; 1-methoxy-2,3,5-trimethylbenzene; (4S)-4-(1-methylethenyl)cyclohex-1-ene-1-carbaldehyde; (-)-Perillaldehyde; L-perillaldehyde; ; 4-isopropenylcyclohex-1-enecarbaldehyde; 4-(prop-1-en-2-yl)cyclohex-1-ene-1-carbaldehyde; Perilla aldehyde |
분자식 |
C10H14O |
분자량 |
150.2176 |
InChI |
InChI=1/C10H14O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,7,10H,1,4-6H2,2H3/t10-/m1/s1 |
cas번호 |
18031-40-8;2111-75-3 |
EC번호 |
243-843-1;218-302-8 |
분자 구조 |
|
밀도 |
1.002g/cm3 |
비등점 |
238°C at 760 mmHg |
굴절 지수 |
1.543 |
인화점 |
95.6°C |
증기압 |
0.0434mmHg at 25°C |
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|