ChemNet > CAS > 1835-11-6 4'-Benzyloxy-3'-methoxyacetophenone
1835-11-6 4'-Benzyloxy-3'-methoxyacetophenone
| 상품명칭 |
4'-Benzyloxy-3'-methoxyacetophenone |
| 영문 이름 |
4'-Benzyloxy-3'-methoxyacetophenone; 4-Benzyloxy-3-methoxyacetophenone; 1-[4-(benzyloxy)-3-methoxyphenyl]ethanone; 1-[3-(benzyloxy)-4-methoxyphenyl]ethanone |
| 분자식 |
C16H16O3 |
| 분자량 |
256.2964 |
| InChI |
InChI=1/C16H16O3/c1-12(17)14-8-9-15(18-2)16(10-14)19-11-13-6-4-3-5-7-13/h3-10H,11H2,1-2H3 |
| cas번호 |
1835-11-6 |
| 분자 구조 |
|
| 밀도 |
1.115g/cm3 |
| 비등점 |
396.5°C at 760 mmHg |
| 굴절 지수 |
1.558 |
| 인화점 |
185.2°C |
| 증기압 |
1.7E-06mmHg at 25°C |
| 보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|