ChemNet > CAS > 1877-71-0 Methyl hydrogen isophthalate
1877-71-0 Methyl hydrogen isophthalate
상품명칭 |
Methyl hydrogen isophthalate |
별명 |
Monomethyl isophthalate; Isophthalic acid monomethyl ester; Benzene-1,3-dicarboxylic acid monomethyl ester; 3-(methoxycarbonyl)benzoic acid; Mono-methyl isophthalate |
분자식 |
C9H8O4 |
분자량 |
180.1574 |
InChI |
InChI=1/C9H8O4/c1-13-9(12)7-4-2-3-6(5-7)8(10)11/h2-5H,1H3,(H,10,11) |
cas번호 |
1877-71-0 |
분자 구조 |
|
밀도 |
1.288g/cm3 |
녹는 점 |
194-196℃ |
비등점 |
339.3°C at 760 mmHg |
굴절 지수 |
1.556 |
인화점 |
139.6°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|