ChemNet > CAS > 19241-36-2 5-Chloro-2-methylphenyl isothiocyanate
19241-36-2 5-Chloro-2-methylphenyl isothiocyanate
| 상품명칭 |
5-Chloro-2-methylphenyl isothiocyanate |
| 별명 |
3-Chloro-6-methylisothiocyanatobenzene; 4-chloro-2-isothiocyanato-1-methylbenzene |
| 분자식 |
C8H6ClNS |
| 분자량 |
183.6579 |
| InChI |
InChI=1/C8H6ClNS/c1-6-2-3-7(9)4-8(6)10-5-11/h2-4H,1H3 |
| cas번호 |
19241-36-2 |
| 분자 구조 |
|
| 밀도 |
1.18g/cm3 |
| 비등점 |
293°C at 760 mmHg |
| 굴절 지수 |
1.583 |
| 인화점 |
131°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
