ChemNet > CAS > 19547-88-7 N,S-diacetyl-L-cysteine methyl ester
19547-88-7 N,S-diacetyl-L-cysteine methyl ester
상품명칭 |
N,S-diacetyl-L-cysteine methyl ester |
영문 이름 |
N,S-diacetyl-L-cysteine methyl ester;N,S-Diacetylcysteine methyl ester; Methyl N,S-diacetyl-L-cysteinate |
분자식 |
C8H13NO4S |
분자량 |
219.2581 |
InChI |
InChI=1/C8H13NO4S/c1-5(10)9-7(8(12)13-3)4-14-6(2)11/h7H,4H2,1-3H3,(H,9,10)/t7-/m0/s1 |
cas번호 |
19547-88-7 |
EC번호 |
243-146-2 |
분자 구조 |
|
밀도 |
1.208g/cm3 |
녹는 점 |
97-100℃ |
비등점 |
379.4°C at 760 mmHg |
굴절 지수 |
1.49 |
인화점 |
183.3°C |
증기압 |
5.85E-06mmHg at 25°C |
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|