ChemNet > CAS > 20426-12-4 4-Hydroxychalcone
20426-12-4 4-Hydroxychalcone
상품명칭 |
4-Hydroxychalcone |
별명 |
4-Hydroxybenzylideneacetophenone; 3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one; (2E)-3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one |
분자식 |
C15H12O2 |
분자량 |
224.2546 |
InChI |
InChI=1/C15H12O2/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13/h1-11,16H/b11-8+ |
cas번호 |
20426-12-4 |
분자 구조 |
|
밀도 |
1.191g/cm3 |
녹는 점 |
183-185℃ |
비등점 |
394.9°C at 760 mmHg |
굴절 지수 |
1.653 |
인화점 |
168.6°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|