ChemNet > CAS > 2088-24-6 3-Methoxyphenoxyacetic acid
2088-24-6 3-Methoxyphenoxyacetic acid
상품명칭 |
3-Methoxyphenoxyacetic acid |
별명 |
Acetic acid, (3-methoxyphenoxy)-; (3-Methoxyphenoxy)acetic acid |
분자식 |
C9H10O4 |
분자량 |
182.1733 |
InChI |
InChI=1/C9H10O4/c1-12-7-3-2-4-8(5-7)13-6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
cas번호 |
2088-24-6 |
분자 구조 |
|
밀도 |
1.226g/cm3 |
비등점 |
325.9°C at 760 mmHg |
굴절 지수 |
1.528 |
인화점 |
131.9°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|