ChemNet > CAS > 2113-51-1 2-Iodobiphenyl
2113-51-1 2-Iodobiphenyl
| 상품명칭 |
2-Iodobiphenyl |
| 별명 |
1,1'-Biphenyl, 2-iodo-; 2-Iodo-1,1'-biphenyl; AI3-15371; Biphenyl, 2-iodo-; NSC 9283; o-Iodobiphenyl; o-Phenyliodobenzene; Biphenyl, 2-iodo- (6CI,7CI,8CI) |
| 분자식 |
C12H9I |
| 분자량 |
280.1043 |
| InChI |
InChI=1/C12H9I/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H |
| cas번호 |
2113-51-1 |
| EC번호 |
218-303-3 |
| 분자 구조 |
|
| 밀도 |
1.584g/cm3 |
| 비등점 |
331.7°C at 760 mmHg |
| 굴절 지수 |
1.64 |
| 인화점 |
150.1°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
