ChemNet > CAS > 2215-89-6 4,4'-oxybis(benzoic acid)
2215-89-6 4,4'-oxybis(benzoic acid)
상품명칭 |
4,4'-oxybis(benzoic acid) |
영문 이름 |
4,4'-oxybis(benzoic acid); 4,4-Dicarboxydiphenyl ether~(Diphenyl ether)-4,4-dicarboxylic acid; 4,4-Diphenyl Ethyl Dicarboxylic Acid; 4,4?Oxybis(benzoic acid); Oxybisbenzoic acid; 4,4'-Oxybisbenzoic acid; 4,4'-Dicarboxydiphenyl ether; Diphenyl ether 4,4'-dicarboxylic acid; 4-(4-carboxyphenoxy)benzoic acid; 4,4'-oxydibenzoic acid; 4,4-Oxybisbenzoic acid; OBBA |
분자식 |
C14H10O5 |
분자량 |
258.2262 |
InChI |
InChI=1/C14H10O5/c15-13(16)9-1-5-11(6-2-9)19-12-7-3-10(4-8-12)14(17)18/h1-8H,(H,15,16)(H,17,18) |
cas번호 |
2215-89-6 |
EC번호 |
218-683-0 |
분자 구조 |
|
밀도 |
1.395g/cm3 |
비등점 |
473.7°C at 760 mmHg |
굴절 지수 |
1.638 |
인화점 |
184.1°C |
증기압 |
8.85E-10mmHg at 25°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|