ChemNet > CAS > 22355-34-6 benzoic acid, compound with dicyclohexylamine (1:1)
22355-34-6 benzoic acid, compound with dicyclohexylamine (1:1)
| 상품명칭 |
benzoic acid, compound with dicyclohexylamine (1:1) |
| 별명 |
Benzoic acid, compd. with N-cyclohexylcyclohexanamine (1:1); Benzoic acid dicyclohexylamine salt; Dicyclohexylamine benzoate; Dicyclohexylammonium benzoate; Benzoic acid, compd. with dicyclohexylamine (1:1) (8CI); Benzoic acid, compound with dicyclohexylamine (1:1); Dicyclohexylamine, compd. with benzoic acid (7CI); N-cyclohexylcyclohexanamine benzoate (1:1) |
| 분자식 |
C19H29NO2 |
| 분자량 |
303.4391 |
| InChI |
InChI=1/C12H23N.C7H6O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;8-7(9)6-4-2-1-3-5-6/h11-13H,1-10H2;1-5H,(H,8,9) |
| cas번호 |
22355-34-6 |
| EC번호 |
244-932-8 |
| 분자 구조 |
|
| 비등점 |
256.1°C at 760 mmHg |
| 인화점 |
96.1°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
|
|
