ChemNet > CAS > 223671-15-6 7-Bromo-1-hydroxyisoquinoline
223671-15-6 7-Bromo-1-hydroxyisoquinoline
상품명칭 |
7-Bromo-1-hydroxyisoquinoline |
별명 |
7-Bromoisocarbostyril; 7-bromoisoquinolin-1(2H)-one; 7-bromo-1(2H)-isoquinolone |
분자식 |
C9H6BrNO |
분자량 |
224.054 |
InChI |
InChI=1/C9H6BrNO/c10-7-2-1-6-3-4-11-9(12)8(6)5-7/h1-5H,(H,11,12) |
cas번호 |
223671-15-6 |
분자 구조 |
|
밀도 |
1.62g/cm3 |
비등점 |
427.5°C at 760 mmHg |
굴절 지수 |
1.63 |
인화점 |
212.4°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|