ChemNet > CAS > 2401-24-3 6-Chloro-m-anisidine
2401-24-3 6-Chloro-m-anisidine
상품명칭 |
6-Chloro-m-anisidine |
별명 |
2-Chloro-5-methoxyaniline; 6-chloro-meta-anisidine; 3-Amino-4-chloroanisole |
분자식 |
C7H9Cl2NO |
분자량 |
194.0585 |
InChI |
InChI=1/C7H8ClNO.ClH/c1-10-5-2-3-6(8)7(9)4-5;/h2-4H,9H2,1H3;1H |
cas번호 |
2401-24-3 |
EC번호 |
219-277-6 |
분자 구조 |
|
녹는 점 |
207℃ |
비등점 |
255°C at 760 mmHg |
인화점 |
108°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|