ChemNet > CAS > 24393-53-1 ethyl trans-4-bromocinnamate
24393-53-1 ethyl trans-4-bromocinnamate
| 상품명칭 |
ethyl trans-4-bromocinnamate |
| 별명 |
2-Propenoic acid, 3-(4-bromophenyl)-, ethyl ester; NSC 636702; ethyl 3-(4-bromophenyl)prop-2-enoate; ethyl (2E)-3-(4-bromophenyl)prop-2-enoate |
| 분자식 |
C11H11BrO2 |
| 분자량 |
255.1078 |
| InChI |
InChI=1/C11H11BrO2/c1-2-14-11(13)8-5-9-3-6-10(12)7-4-9/h3-8H,2H2,1H3/b8-5+ |
| cas번호 |
24393-53-1 |
| 분자 구조 |
|
| 밀도 |
1.393g/cm3 |
| 비등점 |
308.6°C at 760 mmHg |
| 굴절 지수 |
1.579 |
| 인화점 |
150.8°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
