ChemNet > CAS > 24393-53-1 ethyl trans-4-bromocinnamate
24393-53-1 ethyl trans-4-bromocinnamate
상품명칭 |
ethyl trans-4-bromocinnamate |
별명 |
2-Propenoic acid, 3-(4-bromophenyl)-, ethyl ester; NSC 636702; ethyl 3-(4-bromophenyl)prop-2-enoate; ethyl (2E)-3-(4-bromophenyl)prop-2-enoate |
분자식 |
C11H11BrO2 |
분자량 |
255.1078 |
InChI |
InChI=1/C11H11BrO2/c1-2-14-11(13)8-5-9-3-6-10(12)7-4-9/h3-8H,2H2,1H3/b8-5+ |
cas번호 |
24393-53-1 |
분자 구조 |
|
밀도 |
1.393g/cm3 |
비등점 |
308.6°C at 760 mmHg |
굴절 지수 |
1.579 |
인화점 |
150.8°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|