ChemNet > CAS > 24426-16-2 N,N-Diethyldiethylenetriamine
24426-16-2 N,N-Diethyldiethylenetriamine
| 상품명칭 |
N,N-Diethyldiethylenetriamine |
| 별명 |
N,N-Diethyldiethykenetriamine; N-(2-Diethylaminoethyl)ethylenediamine; N'-(2-aminoethyl)-N,N-diethylethane-1,2-diamine; N'-(2-ammonioethyl)-N,N-diethylethane-1,2-diaminium |
| 분자식 |
C8H24N3 |
| 분자량 |
162.2946 |
| InChI |
InChI=1/C8H21N3/c1-3-11(4-2)8-7-10-6-5-9/h10H,3-9H2,1-2H3/p+3 |
| cas번호 |
24426-16-2 |
| EC번호 |
246-242-2 |
| 분자 구조 |
|
| 비등점 |
227°C at 760 mmHg |
| 인화점 |
91.1°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
