ChemNet > CAS > 2444-19-1 4-Hydroxyphenyl benzoate
2444-19-1 4-Hydroxyphenyl benzoate
| 상품명칭 |
4-Hydroxyphenyl benzoate |
| 별명 |
Benzoic acid 4-hydroxyphenyl ester; Hydroquinone monobenzoate; Benzoicacid 4-hydroxyphenylester |
| 분자식 |
C13H10O3 |
| 분자량 |
214.2167 |
| InChI |
InChI=1/C13H10O3/c14-11-6-8-12(9-7-11)16-13(15)10-4-2-1-3-5-10/h1-9,14H |
| cas번호 |
2444-19-1 |
| EC번호 |
219-479-4 |
| 분자 구조 |
|
| 밀도 |
1.25g/cm3 |
| 비등점 |
376.6°C at 760 mmHg |
| 굴절 지수 |
1.615 |
| 인화점 |
164.7°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
