ChemNet > CAS > 2444-37-3 (Methylthio)acetic acid
2444-37-3 (Methylthio)acetic acid
| 상품명칭 |
(Methylthio)acetic acid |
| 별명 |
NSC 263480; (methylsulfanyl)acetic acid |
| 분자식 |
C3H6O2S |
| 분자량 |
106.1435 |
| InChI |
InChI=1/C3H6O2S/c1-6-2-3(4)5/h2H2,1H3,(H,4,5) |
| cas번호 |
2444-37-3 |
| EC번호 |
219-483-6 |
| 분자 구조 |
|
| 밀도 |
1.224g/cm3 |
| 녹는 점 |
13-131℃ |
| 비등점 |
225.9°C at 760 mmHg |
| 굴절 지수 |
1.5 |
| 인화점 |
90.4°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
