ChemNet > CAS > 245536-50-9 2,3-Difluoro-4-methylbenzaldehyde
245536-50-9 2,3-Difluoro-4-methylbenzaldehyde
상품명칭 |
2,3-Difluoro-4-methylbenzaldehyde |
영문 이름 |
2,3-Difluoro-4-methylbenzaldehyde; 2,3-Difluoro-p-tolualdehyde |
분자식 |
C8H6F2O |
분자량 |
156.1294 |
InChI |
InChI=1/C8H6F2O/c1-5-2-3-6(4-11)8(10)7(5)9/h2-4H,1H3 |
cas번호 |
245536-50-9 |
분자 구조 |
|
밀도 |
1.241g/cm3 |
비등점 |
204.2°C at 760 mmHg |
굴절 지수 |
1.513 |
인화점 |
76.1°C |
증기압 |
0.267mmHg at 25°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|