ChemNet > CAS > 2510-55-6 9-Cyanophenanthrene
2510-55-6 9-Cyanophenanthrene
상품명칭 |
9-Cyanophenanthrene |
별명 |
Cyanophenanthrene; phenanthrene-9-carbonitrile |
분자식 |
C15H9N |
분자량 |
203.2387 |
InChI |
InChI=1/C15H9N/c16-10-12-9-11-5-1-2-6-13(11)15-8-4-3-7-14(12)15/h1-9H |
cas번호 |
2510-55-6 |
EC번호 |
219-725-0 |
분자 구조 |
|
밀도 |
1.2g/cm3 |
녹는 점 |
110-112℃ |
비등점 |
413.8°C at 760 mmHg |
굴절 지수 |
1.719 |
인화점 |
205.4°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21:Harmful by inhalation and in contact with skin.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|