ChemNet > CAS > 25154-52-3 4-(2,6-Dimethylheptyl)phenol(O and P)
25154-52-3;1300-16-9 4-(2,6-Dimethylheptyl)phenol(O and P)
상품명칭 |
4-(2,6-Dimethylheptyl)phenol(O and P) |
영문 이름 |
4-(2,6-Dimethylheptyl)phenol(O and P); 2,6-dimethyl-4-heptylphenol,(oandp); hydroxylno.253; monononylphenol; n-nonylphenol; nonyl; nonyl-pheno; nonylphenol(isomermixture); nonylphenol; Nonyl phenol; potassium 2-nonylphenolate; strontium bis(2-nonylphenolate); sodium 2-nonylphenolate; 4-(2,6-dimethylheptyl)phenol; 4-(1,3,5-trimethylhexyl)phenol |
분자식 |
C15H24O |
분자량 |
220.3505 |
InChI |
InChI=1/C15H24O/c1-11(2)9-12(3)10-13(4)14-5-7-15(16)8-6-14/h5-8,11-13,16H,9-10H2,1-4H3 |
cas번호 |
25154-52-3;1300-16-9 |
EC번호 |
246-672-0 |
분자 구조 |
|
밀도 |
0.926g/cm3 |
녹는 점 |
-8℃ |
비등점 |
306.7°C at 760 mmHg |
굴절 지수 |
1.5 |
인화점 |
156.2°C |
물 용해도 |
6 mg l-1 |
증기압 |
0.000418mmHg at 25°C |
|