ChemNet > CAS > 25354-97-6 2-hexyldecanoic acid
25354-97-6 2-hexyldecanoic acid
상품명칭 |
2-hexyldecanoic acid |
별명 |
Hexyldecanoicacid; 2-n-Hexyldecanoic acid |
분자식 |
C16H32O2 |
분자량 |
256.4241 |
InChI |
InChI=1/C16H32O2/c1-3-5-7-9-10-12-14-15(16(17)18)13-11-8-6-4-2/h15H,3-14H2,1-2H3,(H,17,18) |
cas번호 |
25354-97-6 |
EC번호 |
246-885-9 |
분자 구조 |
|
밀도 |
0.891g/cm3 |
녹는 점 |
18℃ |
비등점 |
371°C at 760 mmHg |
굴절 지수 |
1.452 |
인화점 |
207.1°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|