ChemNet > CAS > 25569-53-3 Poly(ethylene succinate)
25569-53-3 Poly(ethylene succinate)
상품명칭 |
Poly(ethylene succinate) |
영문 이름 |
Poly(ethylene succinate); Ethylene glycol succinate; ethane-1,2-diol-butanedioic acid (1:1) |
분자식 |
C6H12O6 |
분자량 |
180.1559 |
InChI |
InChI=1/C4H6O4.C2H6O2/c5-3(6)1-2-4(7)8;3-1-2-4/h1-2H2,(H,5,6)(H,7,8);3-4H,1-2H2 |
cas번호 |
25569-53-3 |
분자 구조 |
|
녹는 점 |
69-72℃ |
비등점 |
236.1°C at 760 mmHg |
인화점 |
110.9°C |
증기압 |
0.0165mmHg at 25°C |
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|