ChemNet > CAS > 25569-97-5 Thiophene-2-carboxylic acid anhydride
25569-97-5 Thiophene-2-carboxylic acid anhydride
상품명칭 |
Thiophene-2-carboxylic acid anhydride |
영문 이름 |
Thiophene-2-carboxylic acid anhydride; Thiophene-2-carboxylic anhydride; 2-Thienic anhydride |
분자식 |
C10H6O3S2 |
분자량 |
238.2828 |
InChI |
InChI=1/C10H6O3S2/c11-9(7-3-1-5-14-7)13-10(12)8-4-2-6-15-8/h1-6H |
cas번호 |
25569-97-5 |
분자 구조 |
|
밀도 |
1.438g/cm3 |
비등점 |
381.3°C at 760 mmHg |
굴절 지수 |
1.64 |
인화점 |
184.4°C |
증기압 |
5.11E-06mmHg at 25°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|