2563-07-7 2-Ethoxy-p-cresol
상품명칭 |
2-Ethoxy-p-cresol |
영문 이름 |
2-Ethoxy-p-cresol; 2-Ethoxy-p-cresol (OH=1); 2-Ethoxy-4-methylphenol |
분자식 |
C9H12O2 |
분자량 |
152.1904 |
InChI |
InChI=1/C9H12O2/c1-3-11-9-6-7(2)4-5-8(9)10/h4-6,10H,3H2,1-2H3 |
cas번호 |
2563-07-7 |
분자 구조 |
|
밀도 |
1.052g/cm3 |
비등점 |
243.7°C at 760 mmHg |
굴절 지수 |
1.524 |
인화점 |
105°C |
증기압 |
0.0203mmHg at 25°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|