ChemNet > CAS > 261762-39-4 2-Chloro-3,6-difluorobenzaldehyde
261762-39-4 2-Chloro-3,6-difluorobenzaldehyde
상품명칭 |
2-Chloro-3,6-difluorobenzaldehyde |
영문 이름 |
2-Chloro-3,6-difluorobenzaldehyde; |
분자식 |
C7H3ClF2O |
분자량 |
176.5479 |
InChI |
InChI=1/C7H3ClF2O/c8-7-4(3-11)5(9)1-2-6(7)10/h1-3H |
cas번호 |
261762-39-4 |
분자 구조 |
|
밀도 |
1.453g/cm3 |
녹는 점 |
46-50℃ |
비등점 |
206.4°C at 760 mmHg |
굴절 지수 |
1.536 |
인화점 |
78.6°C |
증기압 |
0.238mmHg at 25°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|