ChemNet > CAS > 26545-74-4 (9Z,12Z)-octadeca-9,12-dienoic acid, monoester with glycerol
26545-74-4 (9Z,12Z)-octadeca-9,12-dienoic acid, monoester with glycerol
| 상품명칭 |
(9Z,12Z)-octadeca-9,12-dienoic acid, monoester with glycerol |
| 별명 |
Emalsy MU; Glycerin monolinoleate; Glycerol monolinoleate; Glyceryl linoleate; Glyceryl monolinoleate; Linoleic acid monoglyceride; Linolein, mono-; Rikemal MU 100; Sunsoft 8090; (9Z,12Z)-Octadeca-9,12-dienoic acid, monoester with glycerol; 9,12-Octadecadienoic acid (9Z,12Z)-, monoester with 1,2,3-propanetriol; 9,12-Octadecadienoic acid, (Z,Z)-, monoester with 1,2,3-propanetriol; 2,3-dihydroxypropyl octadeca-9,12-dienoate |
| 분자식 |
C21H38O4 |
| 분자량 |
354.524 |
| InChI |
InChI=1/C21H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h6-7,9-10,20,22-23H,2-5,8,11-19H2,1H3 |
| cas번호 |
26545-74-4 |
| EC번호 |
247-788-4 |
| 분자 구조 |
|
| 밀도 |
0.981g/cm3 |
| 비등점 |
485°C at 760 mmHg |
| 굴절 지수 |
1.488 |
| 인화점 |
157°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
|
|
