ChemNet > CAS > 26663-77-4 methyl 1H-benzimidazole-5-carboxylate
26663-77-4 methyl 1H-benzimidazole-5-carboxylate
상품명칭 |
methyl 1H-benzimidazole-5-carboxylate |
별명 |
1H-Benzimidazole-5-carboxylic acid methyl ester; methyl 1H-benzimidazole-6-carboxylate |
분자식 |
C9H8N2O2 |
분자량 |
176.172 |
InChI |
InChI=1/C9H8N2O2/c1-13-9(12)6-2-3-7-8(4-6)11-5-10-7/h2-5H,1H3,(H,10,11) |
cas번호 |
26663-77-4 |
분자 구조 |
|
밀도 |
1.324g/cm3 |
비등점 |
416.2°C at 760 mmHg |
굴절 지수 |
1.648 |
인화점 |
205.5°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|