ChemNet > CAS > 2693-46-1 3-Aminofluoranthene
2693-46-1 3-Aminofluoranthene
| 상품명칭 |
3-Aminofluoranthene |
| 별명 |
3-Fluoranthenamine; fluoranthen-3-ylamine; fluoranthen-3-amine |
| 분자식 |
C16H11N |
| 분자량 |
217.2652 |
| InChI |
InChI=1/C16H11N/c17-15-9-8-13-11-5-2-1-4-10(11)12-6-3-7-14(15)16(12)13/h1-9H,17H2 |
| cas번호 |
2693-46-1 |
| EC번호 |
220-263-7 |
| 분자 구조 |
|
| 밀도 |
1.322g/cm3 |
| 녹는 점 |
115-117℃ |
| 비등점 |
440.8°C at 760 mmHg |
| 굴절 지수 |
1.904 |
| 인화점 |
246.2°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
