ChemNet > CAS > 2906-60-7 4,4'-Dithiodibutyric acid
2906-60-7 4,4'-Dithiodibutyric acid
| 상품명칭 |
4,4'-Dithiodibutyric acid |
| 별명 |
Dithiodibutyricacid; 4,4-Dithiodibutyric acid; Bis(3-carboxypropyl) disulphide~3-Carboxypropyl disulphide; 3-Carboxypropyl disulfide; 4,4'-disulfanediyldibutanoic acid; 4,4'-disulfanediyldibutanoate |
| 분자식 |
C8H12O4S2 |
| 분자량 |
236.3096 |
| InChI |
InChI=1/C8H14O4S2/c9-7(10)3-1-5-13-14-6-2-4-8(11)12/h1-6H2,(H,9,10)(H,11,12)/p-2 |
| cas번호 |
2906-60-7 |
| EC번호 |
220-818-3 |
| 분자 구조 |
|
| 녹는 점 |
105-110℃ |
| 비등점 |
467.1°C at 760 mmHg |
| 인화점 |
236.3°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
