ChemNet > CAS > 29681-45-6 Methyl 5-methylnicotinate
29681-45-6 Methyl 5-methylnicotinate
상품명칭 |
Methyl 5-methylnicotinate |
별명 |
Methyl 5-methylpyridine-3-carboxylate; 5-Methylnicotinic acid methyl ester; 5-Methyl-nicotinic acid methyl ester |
분자식 |
C8H9NO2 |
분자량 |
151.1626 |
InChI |
InChI=1/C8H9NO2/c1-6-3-7(5-9-4-6)8(10)11-2/h3-5H,1-2H3 |
cas번호 |
29681-45-6 |
분자 구조 |
|
밀도 |
1.104g/cm3 |
비등점 |
228.5°C at 760 mmHg |
굴절 지수 |
1.51 |
인화점 |
92°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|