ChemNet > CAS > 2981-10-4 1-(1-Piperidino)cyclohexene
2981-10-4 1-(1-Piperidino)cyclohexene
| 상품명칭 |
1-(1-Piperidino)cyclohexene |
| 별명 |
1-(Cyclohexen-1-yl)piperidine; 1-(cyclohex-1-en-1-yl)piperidine; 1-Piperidino-1-cyclohexene |
| 분자식 |
C11H19N |
| 분자량 |
165.2753 |
| InChI |
InChI=1/C11H19N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h7H,1-6,8-10H2 |
| cas번호 |
2981-10-4 |
| 분자 구조 |
|
| 밀도 |
0.978g/cm3 |
| 비등점 |
262.2°C at 760 mmHg |
| 굴절 지수 |
1.527 |
| 인화점 |
102.8°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
