ChemNet > CAS > 3042-81-7 methyl alpha-bromophenylacetate
3042-81-7 methyl alpha-bromophenylacetate
| 상품명칭 |
methyl alpha-bromophenylacetate |
| 별명 |
Acetic acid, bromophenyl-, methyl ester; Benzeneacetic acid, .alpha.-bromo-, methyl ester; benzeneacetic acid, alpha-bromo-, methyl ester; Methyl .alpha.-bromo-.alpha.-phenylacetate; Methyl .alpha.-bromobenzeneacetate; Methyl .alpha.-bromophenylacetate; Methyl bromo(phenyl)acetate; Methyl bromophenylacetate; methyl (2S)-bromo(phenyl)ethanoate; methyl (2R)-bromo(phenyl)ethanoate; 2-Bromo-2-phenylacetic acid methyl ester |
| 분자식 |
C9H9BrO2 |
| 분자량 |
229.0706 |
| InChI |
InChI=1/C9H9BrO2/c1-12-9(11)8(10)7-5-3-2-4-6-7/h2-6,8H,1H3/t8-/m1/s1 |
| cas번호 |
3042-81-7 |
| 분자 구조 |
|
| 밀도 |
1.466g/cm3 |
| 비등점 |
273.3°C at 760 mmHg |
| 굴절 지수 |
1.552 |
| 인화점 |
105.4°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
