ChemNet > CAS > 30742-59-7 5-nitro-2-pyrrolidin-1-yl-benzaldehyde
30742-59-7 5-nitro-2-pyrrolidin-1-yl-benzaldehyde
상품명칭 |
5-nitro-2-pyrrolidin-1-yl-benzaldehyde |
분자식 |
C11H12N2O3 |
분자량 |
220.2246 |
InChI |
InChI=1/C11H12N2O3/c14-8-9-7-10(13(15)16)3-4-11(9)12-5-1-2-6-12/h3-4,7-8H,1-2,5-6H2 |
cas번호 |
30742-59-7 |
분자 구조 |
|
밀도 |
1.314g/cm3 |
녹는 점 |
136℃ |
비등점 |
402.1°C at 760 mmHg |
굴절 지수 |
1.632 |
인화점 |
197°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|