ChemNet > CAS > 31545-26-3 4-클로로-3-니트로페닐 시클로프로필 케톤
31545-26-3 4-클로로-3-니트로페닐 시클로프로필 케톤
| 상품명칭 |
4-클로로-3-니트로페닐 시클로프로필 케톤 |
| 별명 |
(4-클로로-3-니트로페닐) (시클로프로필)메탄온 |
| 영문 이름 |
4-Chloro-3-nitrophenyl cyclopropyl ketone;(4-chloro-3-nitrophenyl)(cyclopropyl)methanone |
| 분자식 |
C10H8ClNO3 |
| 분자량 |
225.6284 |
| InChI |
InChI=1/C10H8ClNO3/c11-8-4-3-7(5-9(8)12(14)15)10(13)6-1-2-6/h3-6H,1-2H2 |
| cas번호 |
31545-26-3 |
| EC번호 |
250-690-4 |
| 분자 구조 |
|
| 밀도 |
1.464g/cm3 |
| 녹는 점 |
78-80℃ |
| 비등점 |
333.4°C at 760 mmHg |
| 굴절 지수 |
1.631 |
| 인화점 |
155.4°C |
| 증기압 |
0.000137mmHg at 25°C |
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|