ChemNet > CAS > 31909-58-7 2-Furoylacetonitrile
31909-58-7 2-Furoylacetonitrile
상품명칭 |
2-Furoylacetonitrile |
별명 |
3-(furan-2-yl)-3-oxopropanenitrile |
분자식 |
C7H5NO2 |
분자량 |
135.1201 |
InChI |
InChI=1/C7H5NO2/c8-4-3-6(9)7-2-1-5-10-7/h1-2,5H,3H2 |
cas번호 |
31909-58-7 |
분자 구조 |
|
밀도 |
1.188g/cm3 |
녹는 점 |
76-83℃ |
비등점 |
297.2°C at 760 mmHg |
굴절 지수 |
1.494 |
인화점 |
133.6°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|