ChemNet > CAS > 3261-87-8 Thiodiglycolic anhydride
3261-87-8 Thiodiglycolic anhydride
상품명칭 |
Thiodiglycolic anhydride |
별명 |
1,4-Oxathiane-2,6-dione; 2,2-Thiodiacetic acid anhydride; 1,4-oxathiane-2,6-dione |
분자식 |
C4H4O3S |
분자량 |
132.1378 |
InChI |
InChI=1/C4H4O3S/c5-3-1-8-2-4(6)7-3/h1-2H2 |
cas번호 |
3261-87-8 |
분자 구조 |
|
밀도 |
1.468g/cm3 |
녹는 점 |
93-94℃ |
비등점 |
341.8°C at 760 mmHg |
굴절 지수 |
1.545 |
인화점 |
190.5°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|