ChemNet > CAS > 32852-81-6 3-Phenoxyphenylacetic acid
32852-81-6 3-Phenoxyphenylacetic acid
상품명칭 |
3-Phenoxyphenylacetic acid |
별명 |
3-Phenoxyphenylacetic |
분자식 |
C14H12O3 |
분자량 |
228.2433 |
InChI |
InChI=1/C14H12O3/c15-14(16)10-11-5-4-8-13(9-11)17-12-6-2-1-3-7-12/h1-9H,10H2,(H,15,16) |
cas번호 |
32852-81-6 |
분자 구조 |
|
밀도 |
1.217g/cm3 |
비등점 |
385.4°C at 760 mmHg |
굴절 지수 |
1.596 |
인화점 |
147.4°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|