ChemNet > CAS > 331-62-4 3-fluoro-4-methoxybenzonitrile
331-62-4 3-fluoro-4-methoxybenzonitrile
상품명칭 |
3-fluoro-4-methoxybenzonitrile |
영문 이름 |
3-fluoro-4-methoxybenzonitrile; Fluoromethoxybenzonitrile |
분자식 |
C8H6FNO |
분자량 |
151.1377 |
InChI |
InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
cas번호 |
331-62-4 |
분자 구조 |
|
밀도 |
1.18g/cm3 |
비등점 |
254.3°C at 760 mmHg |
굴절 지수 |
1.505 |
인화점 |
107.6°C |
증기압 |
0.0173mmHg at 25°C |
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|