ChemNet > CAS > 33577-16-1 Methyl methylsulfinylmethyl sulfide
33577-16-1 Methyl methylsulfinylmethyl sulfide
| 상품명칭 |
Methyl methylsulfinylmethyl sulfide |
| 별명 |
Methyl (methylthio)methyl sulphoxide; MMTS; Formaldehyde dimethyl thioacetal monoxide; Methyl (methylsulphinyl)methyl sulphide; (methylsulfanyl)(methylsulfinyl)methane; (methylsulfanyl)[(R)-methylsulfinyl]methane; (methylsulfanyl)[(S)-methylsulfinyl]methane |
| 분자식 |
C3H8OS2 |
| 분자량 |
124.225 |
| InChI |
InChI=1/C3H8OS2/c1-5-3-6(2)4/h3H2,1-2H3/t6-/m0/s1 |
| cas번호 |
33577-16-1 |
| EC번호 |
251-577-2 |
| 분자 구조 |
|
| 밀도 |
1.223g/cm3 |
| 녹는 점 |
222-226℃ |
| 비등점 |
257.772°C at 760 mmHg |
| 굴절 지수 |
1.56 |
| 인화점 |
121.4°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
