ChemNet > CAS > 33733-73-2 3-Bromothioanisole
33733-73-2 3-Bromothioanisole
상품명칭 |
3-Bromothioanisole |
별명 |
3-Bromophenyl methyl sulphide; 3-Bromothioanisol/3-Bromophenyl methyl sulphide; 1-Bromo-3-(methylthio)benzene; m-Bromothioanisole; 1-bromo-3-(methylsulfanyl)benzene; 1-(bromosulfanyl)-3-methoxybenzene |
분자식 |
C7H7BrOS |
분자량 |
219.0989 |
InChI |
InChI=1/C7H7BrOS/c1-9-6-3-2-4-7(5-6)10-8/h2-5H,1H3 |
cas번호 |
33733-73-2 |
분자 구조 |
|
밀도 |
1.567g/cm3 |
비등점 |
278.106°C at 760 mmHg |
굴절 지수 |
1.616 |
인화점 |
121.995°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S23:;
S24/25:;
|
|