ChemNet > CAS > 344-14-9 dimethyl fluoromalonate
344-14-9 dimethyl fluoromalonate
상품명칭 |
dimethyl fluoromalonate |
별명 |
Fluoromalonic acid dimethyl ester; dimethyl fluoropropanedioate; 2-Fluoro-malonic acid dimethyl ester |
분자식 |
C5H7FO4 |
분자량 |
150.1051 |
InChI |
InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
cas번호 |
344-14-9 |
분자 구조 |
|
밀도 |
1.211g/cm3 |
비등점 |
140.3°C at 760 mmHg |
굴절 지수 |
1.382 |
인화점 |
38.4°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|