ChemNet > CAS > 34590-94-8 dipropylene glycol monomethyl ether, mixture of isomers
34590-94-8 dipropylene glycol monomethyl ether, mixture of isomers
| 상품명칭 |
dipropylene glycol monomethyl ether, mixture of isomers |
| 영문 이름 |
dipropylene glycol monomethyl ether, mixture of isomers; Di(propylene glycol) methyl ether; Methoxypropoxypropanol; Dipropylene glycol monomethyl ether; DPM |
| 분자식 |
C7H16O3 |
| 분자량 |
148.2001 |
| InChI |
InChI=1/C7H16O3/c1-3-7(8)10-6-4-5-9-2/h7-8H,3-6H2,1-2H3 |
| cas번호 |
34590-94-8 |
| EC번호 |
252-104-2 |
| 분자 구조 |
|
| 밀도 |
0.958g/cm3 |
| 비등점 |
155.6°C at 760 mmHg |
| 굴절 지수 |
1.423 |
| 인화점 |
47.9°C |
| 증기압 |
1.09mmHg at 25°C |
| 보안 규칙 |
S23:;
S24/25:;
|
|