ChemNet > CAS > 35354-29-1 3,5-Diacetoxy Benzoic Acid
35354-29-1 3,5-Diacetoxy Benzoic Acid
상품명칭 |
3,5-Diacetoxy Benzoic Acid |
별명 |
3,5-Diacetoxybenzoic acid; 3,5-bis(acetyloxy)benzoic acid |
분자식 |
C11H10O6 |
분자량 |
238.1935 |
InChI |
InChI=1/C11H10O6/c1-6(12)16-9-3-8(11(14)15)4-10(5-9)17-7(2)13/h3-5H,1-2H3,(H,14,15) |
cas번호 |
35354-29-1 |
분자 구조 |
|
밀도 |
1.344g/cm3 |
비등점 |
408.4°C at 760 mmHg |
굴절 지수 |
1.543 |
인화점 |
160.4°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|