ChemNet > CAS > 3550-21-8 Benzhydryl isothiocyanate
3550-21-8 Benzhydryl isothiocyanate
| 상품명칭 |
Benzhydryl isothiocyanate |
| 영문 이름 |
Benzhydryl isothiocyanate; Diphenylmethyl isothiocyanate; 1,1'-(isothiocyanatomethanediyl)dibenzene |
| 분자식 |
C14H11NS |
| 분자량 |
225.3088 |
| InChI |
InChI=1/C14H11NS/c16-11-15-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14H |
| cas번호 |
3550-21-8 |
| 분자 구조 |
|
| 밀도 |
1.05g/cm3 |
| 녹는 점 |
58℃ |
| 비등점 |
333.3°C at 760 mmHg |
| 굴절 지수 |
1.59 |
| 인화점 |
163°C |
| 증기압 |
0.000266mmHg at 25°C |
| 위험성 표시 |
Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|